C31H43ClN2O3S — CID 87213702
tert-butyl 7-chloro-2-[(4-methoxyphenyl)methyl]-3-sulfanylidenespiro[isoindole-1,4'-piperidine]-1'-carboxylate;hexane (PubChem CID 87213702) has the molecular formula C31H43ClN2O3S and a molecular weight of 559.22 g/mol. Its IUPAC name is tert-butyl 7-chloro-2-[(4-methoxyphenyl)methyl]-3-sulfanylidenespiro[isoindole-1,4'-piperidine]-1'-carboxylate;hexane.
| Compound Name | tert-butyl 7-chloro-2-[(4-methoxyphenyl)methyl]-3-sulfanylidenespiro[isoindole-1,4'-piperidine]-1'-carboxylate;hexane |
|---|---|
| PubChem CID | 87213702 |
| Molecular Formula | C31H43ClN2O3S |
| Molecular Weight | 559.22 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | tert-butyl 7-chloro-2-[(4-methoxyphenyl)methyl]-3-sulfanylidenespiro[isoindole-1,4'-piperidine]-1'-carboxylate;hexane |
| SMILES | CCCCCC.COc1ccc(CN2C(=S)c3cccc(Cl)c3C23CCN(C(=O)OC(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C25H29ClN2O3S.C6H14/c1-24(2,3)31-23(29)27-14-12-25(13-15-27)21-19(6-5-7-20(21)26)22(32)28(25)16-17-8-10-18(30-4)11-9-17;1-3-5-6-4-2/h5-11H,12-16H2,1-4H3;3-6H2,1-2H3 |
| InChIKey | VWBCJFBVPQVXRK-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.22 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|