About ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate
ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate (PubChem CID 87213906) has the molecular formula C23H25F2NO2
and a molecular weight of 385.45 g/mol. Its IUPAC name is ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate |
| PubChem CID | 87213906 |
| Molecular Formula | C23H25F2NO2 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate |
| SMILES | CCOC(=O)[C@@H](CC(F)(F)CC1CC1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25F2NO2/c1-2-28-22(27)20(16-23(24,25)15-17-13-14-17)26-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17,20H,2,13-16H2,1H3/t20-/m1/s1 |
| InChIKey | OKMJBZYBLFYOLX-HXUWFJFHSA-N |
| XLogP | 5.28 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate?
The IUPAC name of ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate (CID 87213906) is ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate.
What is the SMILES notation for ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate?
The canonical SMILES for ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate is CCOC(=O)[C@@H](CC(F)(F)CC1CC1)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate?
The InChIKey is OKMJBZYBLFYOLX-HXUWFJFHSA-N. The full InChI is InChI=1S/C23H25F2NO2/c1-2-28-22(27)20(16-23(24,25)15-17-13-14-17)26-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17,20H,2,13-16H2,1H3/t20-/m1/s1.
What are the key properties of ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate?
ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate has a molecular weight of 385.45 g/mol, XLogP of 5.28, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoate is sourced from PubChem (CID 87213906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).