About 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid
2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid (PubChem CID 87213907) has the molecular formula C23H25F2NO2
and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid.
Molecular Properties
| Compound Name | 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid |
| PubChem CID | 87213907 |
| Molecular Formula | C23H25F2NO2 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid |
| SMILES | CCC(C1CC1)C(F)(F)CC(N=C(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H25F2NO2/c1-2-19(16-13-14-16)23(24,25)15-20(22(27)28)26-21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19-20H,2,13-15H2,1H3,(H,27,28) |
| InChIKey | JZTFNZMHQDFFQE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid?
The IUPAC name of 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid (CID 87213907) is 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid.
What is the SMILES notation for 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid?
The canonical SMILES for 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid is CCC(C1CC1)C(F)(F)CC(N=C(c1ccccc1)c1ccccc1)C(=O)O.
What is the InChIKey of 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid?
The InChIKey is JZTFNZMHQDFFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25F2NO2/c1-2-19(16-13-14-16)23(24,25)15-20(22(27)28)26-21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19-20H,2,13-15H2,1H3,(H,27,28).
What are the key properties of 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid?
2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid has a molecular weight of 385.45 g/mol, XLogP of 5.44, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoroheptanoic acid is sourced from PubChem (CID 87213907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).