About (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid
(2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid (PubChem CID 87214109) has the molecular formula C21H21F2NO2
and a molecular weight of 357.40 g/mol. Its IUPAC name is (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid.
Molecular Properties
| Compound Name | (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid |
| PubChem CID | 87214109 |
| Molecular Formula | C21H21F2NO2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid |
| SMILES | O=C(O)[C@@H](CC(F)(F)CC1CC1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21F2NO2/c22-21(23,13-15-11-12-15)14-18(20(25)26)24-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,18H,11-14H2,(H,25,26)/t18-/m1/s1 |
| InChIKey | RWESXJDKQKETQO-GOSISDBHSA-N |
| XLogP | 4.80 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid?
The IUPAC name of (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid (CID 87214109) is (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid.
What is the SMILES notation for (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid?
The canonical SMILES for (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid is O=C(O)[C@@H](CC(F)(F)CC1CC1)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid?
The InChIKey is RWESXJDKQKETQO-GOSISDBHSA-N. The full InChI is InChI=1S/C21H21F2NO2/c22-21(23,13-15-11-12-15)14-18(20(25)26)24-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,18H,11-14H2,(H,25,26)/t18-/m1/s1.
What are the key properties of (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid?
(2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid has a molecular weight of 357.40 g/mol, XLogP of 4.80, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid is sourced from PubChem (CID 87214109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).