C23H28FN4O5P — CID 87214144
6-(3-diethoxyphosphorylpropoxy)-4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methylpyrrolo[2,1-f][1,2,4]triazine (PubChem CID 87214144) has the molecular formula C23H28FN4O5P and a molecular weight of 490.47 g/mol. Its IUPAC name is 6-(3-diethoxyphosphorylpropoxy)-4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methylpyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 6-(3-diethoxyphosphorylpropoxy)-4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methylpyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 87214144 |
| Molecular Formula | C23H28FN4O5P |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 6-(3-diethoxyphosphorylpropoxy)-4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methylpyrrolo[2,1-f][1,2,4]triazine |
| SMILES | CCOP(=O)(CCCOc1cn2ncnc(Oc3ccc4[nH]c(C)cc4c3F)c2c1C)OCC |
| InChI | InChI=1S/C23H28FN4O5P/c1-5-31-34(29,32-6-2)11-7-10-30-20-13-28-22(16(20)4)23(25-14-26-28)33-19-9-8-18-17(21(19)24)12-15(3)27-18/h8-9,12-14,27H,5-7,10-11H2,1-4H3 |
| InChIKey | UTOIRJOCEQSWCU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|