C30H48O7Si — CID 87214193
(E)-4-[(2R,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enal (PubChem CID 87214193) has the molecular formula C30H48O7Si and a molecular weight of 548.79 g/mol. Its IUPAC name is (E)-4-[(2R,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enal.
| Compound Name | (E)-4-[(2R,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enal |
|---|---|
| PubChem CID | 87214193 |
| Molecular Formula | C30H48O7Si |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | (E)-4-[(2R,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enal |
| SMILES | CO[C@]1(C(C)(C)/C=C/C=O)O[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)OCOCc2ccccc2)CCC1=O |
| InChI | InChI=1S/C30H48O7Si/c1-23(35-22-34-21-24-14-11-10-12-15-24)26(37-38(8,9)28(2,3)4)20-25-16-17-27(32)30(33-7,36-25)29(5,6)18-13-19-31/h10-15,18-19,23,25-26H,16-17,20-22H2,1-9H3/b18-13+/t23-,25+,26-,30+/m1/s1 |
| InChIKey | MJQKOCSZZPCMTR-AJLZVJMISA-N |
| XLogP | 6.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|