C15H21Br3 — CID 87214432
1,3,5-tris(2-bromoethyl)-2,4,6-trimethylbenzene (PubChem CID 87214432) has the molecular formula C15H21Br3 and a molecular weight of 441.05 g/mol. Its IUPAC name is 1,3,5-tris(2-bromoethyl)-2,4,6-trimethylbenzene.
| Compound Name | 1,3,5-tris(2-bromoethyl)-2,4,6-trimethylbenzene |
|---|---|
| PubChem CID | 87214432 |
| Molecular Formula | C15H21Br3 |
| Molecular Weight | 441.05 g/mol |
| Exact Mass | 437.92 |
| IUPAC Name | 1,3,5-tris(2-bromoethyl)-2,4,6-trimethylbenzene |
| SMILES | Cc1c(CCBr)c(C)c(CCBr)c(C)c1CCBr |
| InChI | InChI=1S/C15H21Br3/c1-10-13(4-7-16)11(2)15(6-9-18)12(3)14(10)5-8-17/h4-9H2,1-3H3 |
| InChIKey | MQQPWPCJRYKCMO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.05 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|