About CID 87214702
CID 87214702 (PubChem CID 87214702) has the molecular formula C14H8BF6O2S2
and a molecular weight of 397.15 g/mol.
Molecular Properties
| Compound Name | CID 87214702 |
| PubChem CID | 87214702 |
| Molecular Formula | C14H8BF6O2S2 |
| Molecular Weight | 397.15 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | — |
| SMILES | FC(F)(F)Sc1ccc(O[B]Oc2ccc(SC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H8BF6O2S2/c16-13(17,18)24-11-5-1-9(2-6-11)22-15-23-10-3-7-12(8-4-10)25-14(19,20)21/h1-8H |
| InChIKey | KPUVROKXIYKQBY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.15 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87214702 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87214702?
The IUPAC name of CID 87214702 (CID 87214702) is not available.
What is the SMILES notation for CID 87214702?
The canonical SMILES for CID 87214702 is FC(F)(F)Sc1ccc(O[B]Oc2ccc(SC(F)(F)F)cc2)cc1.
What is the InChIKey of CID 87214702?
The InChIKey is KPUVROKXIYKQBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BF6O2S2/c16-13(17,18)24-11-5-1-9(2-6-11)22-15-23-10-3-7-12(8-4-10)25-14(19,20)21/h1-8H.
What are the key properties of CID 87214702?
CID 87214702 has a molecular weight of 397.15 g/mol, XLogP of 5.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87214702 is sourced from PubChem (CID 87214702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).