About bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane
bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane (PubChem CID 87214745) has the molecular formula C24H28O2P-
and a molecular weight of 379.46 g/mol. Its IUPAC name is bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane.
Molecular Properties
| Compound Name | bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane |
| PubChem CID | 87214745 |
| Molecular Formula | C24H28O2P- |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane |
| SMILES | COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)c2[cH-]ccc2C)cc1C |
| InChI | InChI=1S/C24H28O2P/c1-15-9-8-10-22(15)27(20-11-16(2)23(25-6)17(3)12-20)21-13-18(4)24(26-7)19(5)14-21/h8-14H,1-7H3/q-1 |
| InChIKey | XHAVYHSMYGBXFC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane?
The IUPAC name of bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane (CID 87214745) is bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane.
What is the SMILES notation for bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane?
The canonical SMILES for bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane is COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)c2[cH-]ccc2C)cc1C.
What is the InChIKey of bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane?
The InChIKey is XHAVYHSMYGBXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O2P/c1-15-9-8-10-22(15)27(20-11-16(2)23(25-6)17(3)12-20)21-13-18(4)24(26-7)19(5)14-21/h8-14H,1-7H3/q-1.
What are the key properties of bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane?
bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane has a molecular weight of 379.46 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methoxy-3,5-dimethylphenyl)-(2-methylcyclopenta-1,3-dien-1-yl)phosphane is sourced from PubChem (CID 87214745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).