About 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid
2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid (PubChem CID 87214776) has the molecular formula C5H11N3O5
and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid.
Molecular Properties
| Compound Name | 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid |
| PubChem CID | 87214776 |
| Molecular Formula | C5H11N3O5 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid |
| SMILES | O=C(O)O.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C4H9N3O2.CH2O3/c1-7(4(5)6)2-3(8)9;2-1(3)4/h2H2,1H3,(H3,5,6)(H,8,9);(H2,2,3,4) |
| InChIKey | KSIJDBILPUMVDQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid?
The IUPAC name of 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid (CID 87214776) is 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid.
What is the SMILES notation for 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid?
The canonical SMILES for 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid is O=C(O)O.[H]/N=C(\N)N(C)CC(=O)O.
What is the InChIKey of 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid?
The InChIKey is KSIJDBILPUMVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O2.CH2O3/c1-7(4(5)6)2-3(8)9;2-1(3)4/h2H2,1H3,(H3,5,6)(H,8,9);(H2,2,3,4).
What are the key properties of 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid?
2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid has a molecular weight of 193.16 g/mol, XLogP of -0.88, 2 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid is sourced from PubChem (CID 87214776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).