2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid

C5H11N3O5 — CID 87214776

IUPAC2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid
SMILESO=C(O)O.[H]/N=C(\N)N(C)CC(=O)O
InChIInChI=1S/C4H9N3O2.CH2O3/c1-7(4(5)6)2-3(8)9;2-1(3)4/h2H2,1H3,(H3,5,6)(H,8,9);(H2,2,3,4)
InChIKeyKSIJDBILPUMVDQ-UHFFFAOYSA-N
MW193.16 g/mol
LogP-0.88
Rot. Bonds2

About 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid

2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid (PubChem CID 87214776) has the molecular formula C5H11N3O5 and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid.

Molecular Properties

Compound Name2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid
PubChem CID87214776
Molecular FormulaC5H11N3O5
Molecular Weight193.16 g/mol
Exact Mass193.07
IUPAC Name2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid
SMILESO=C(O)O.[H]/N=C(\N)N(C)CC(=O)O
InChIInChI=1S/C4H9N3O2.CH2O3/c1-7(4(5)6)2-3(8)9;2-1(3)4/h2H2,1H3,(H3,5,6)(H,8,9);(H2,2,3,4)
InChIKeyKSIJDBILPUMVDQ-UHFFFAOYSA-N
XLogP-0.88
TPSA147.94 Ų
H-Bond Donors5
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.16
LogP ≤ 5-0.88
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid?
The IUPAC name of 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid (CID 87214776) is 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid.
What is the SMILES notation for 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid?
The canonical SMILES for 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid is O=C(O)O.[H]/N=C(\N)N(C)CC(=O)O.
What is the InChIKey of 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid?
The InChIKey is KSIJDBILPUMVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O2.CH2O3/c1-7(4(5)6)2-3(8)9;2-1(3)4/h2H2,1H3,(H3,5,6)(H,8,9);(H2,2,3,4).
What are the key properties of 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid?
2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid has a molecular weight of 193.16 g/mol, XLogP of -0.88, 2 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carbamimidoyl(methyl)amino]acetic acid;carbonic acid is sourced from PubChem (CID 87214776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).