About N,N-dimethylmethanamine;bis(N-methylmethanamine)
N,N-dimethylmethanamine;bis(N-methylmethanamine) (PubChem CID 87214802) has the molecular formula C7H23N3
and a molecular weight of 149.28 g/mol. Its IUPAC name is N,N-dimethylmethanamine;bis(N-methylmethanamine).
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;bis(N-methylmethanamine) |
| PubChem CID | 87214802 |
| Molecular Formula | C7H23N3 |
| Molecular Weight | 149.28 g/mol |
| Exact Mass | 149.19 |
| IUPAC Name | N,N-dimethylmethanamine;bis(N-methylmethanamine) |
| SMILES | CN(C)C.CNC.CNC |
| InChI | InChI=1S/C3H9N.2C2H7N/c1-4(2)3;2*1-3-2/h1-3H3;2*3H,1-2H3 |
| InChIKey | UKRDSNLHWXRHCV-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethylmethanamine;bis(N-methylmethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;bis(N-methylmethanamine)?
The IUPAC name of N,N-dimethylmethanamine;bis(N-methylmethanamine) (CID 87214802) is N,N-dimethylmethanamine;bis(N-methylmethanamine).
What is the SMILES notation for N,N-dimethylmethanamine;bis(N-methylmethanamine)?
The canonical SMILES for N,N-dimethylmethanamine;bis(N-methylmethanamine) is CN(C)C.CNC.CNC.
What is the InChIKey of N,N-dimethylmethanamine;bis(N-methylmethanamine)?
The InChIKey is UKRDSNLHWXRHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.2C2H7N/c1-4(2)3;2*1-3-2/h1-3H3;2*3H,1-2H3.
What are the key properties of N,N-dimethylmethanamine;bis(N-methylmethanamine)?
N,N-dimethylmethanamine;bis(N-methylmethanamine) has a molecular weight of 149.28 g/mol, XLogP of -0.15, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;bis(N-methylmethanamine) is sourced from PubChem (CID 87214802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).