C14H24N+ — CID 87215829
trimethyl-(2,3,4,5,6-pentamethylphenyl)azanium (PubChem CID 87215829) has the molecular formula C14H24N+ and a molecular weight of 206.35 g/mol. Its IUPAC name is trimethyl-(2,3,4,5,6-pentamethylphenyl)azanium.
| Compound Name | trimethyl-(2,3,4,5,6-pentamethylphenyl)azanium |
|---|---|
| PubChem CID | 87215829 |
| Molecular Formula | C14H24N+ |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.19 |
| IUPAC Name | trimethyl-(2,3,4,5,6-pentamethylphenyl)azanium |
| SMILES | Cc1c(C)c(C)c([N+](C)(C)C)c(C)c1C |
| InChI | InChI=1S/C14H24N/c1-9-10(2)12(4)14(15(6,7)8)13(5)11(9)3/h1-8H3/q+1 |
| InChIKey | WIZOTUGZKNGABY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|