C10H11F3N2O — CID 87216278
N-(2,4-dimethylphenyl)-2,2,2-trifluoroacetohydrazide (PubChem CID 87216278) has the molecular formula C10H11F3N2O and a molecular weight of 232.21 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2,2,2-trifluoroacetohydrazide.
| Compound Name | N-(2,4-dimethylphenyl)-2,2,2-trifluoroacetohydrazide |
|---|---|
| PubChem CID | 87216278 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2,2,2-trifluoroacetohydrazide |
| SMILES | Cc1ccc(N(N)C(=O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C10H11F3N2O/c1-6-3-4-8(7(2)5-6)15(14)9(16)10(11,12)13/h3-5H,14H2,1-2H3 |
| InChIKey | NKOGHLLTVMZTNG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|