About ethenol;octadecanoic acid
ethenol;octadecanoic acid (PubChem CID 87216470) has the molecular formula C20H40O3
and a molecular weight of 328.54 g/mol. Its IUPAC name is ethenol;octadecanoic acid.
Molecular Properties
| Compound Name | ethenol;octadecanoic acid |
| PubChem CID | 87216470 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | ethenol;octadecanoic acid |
| SMILES | C=CO.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2.C2H4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3/h2-17H2,1H3,(H,19,20);2-3H,1H2 |
| InChIKey | MHHCRWYHGUDNSG-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethenol;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;octadecanoic acid?
The IUPAC name of ethenol;octadecanoic acid (CID 87216470) is ethenol;octadecanoic acid.
What is the SMILES notation for ethenol;octadecanoic acid?
The canonical SMILES for ethenol;octadecanoic acid is C=CO.CCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of ethenol;octadecanoic acid?
The InChIKey is MHHCRWYHGUDNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C2H4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3/h2-17H2,1H3,(H,19,20);2-3H,1H2.
What are the key properties of ethenol;octadecanoic acid?
ethenol;octadecanoic acid has a molecular weight of 328.54 g/mol, XLogP of 7.02, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;octadecanoic acid is sourced from PubChem (CID 87216470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).