C30H20F3N5O2 — CID 87216636
N-(3-aminophenyl)-N-[3-[(6-dibenzofuran-4-ylpyrimidin-4-yl)amino]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 87216636) has the molecular formula C30H20F3N5O2 and a molecular weight of 539.52 g/mol. Its IUPAC name is N-(3-aminophenyl)-N-[3-[(6-dibenzofuran-4-ylpyrimidin-4-yl)amino]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-aminophenyl)-N-[3-[(6-dibenzofuran-4-ylpyrimidin-4-yl)amino]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87216636 |
| Molecular Formula | C30H20F3N5O2 |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | N-(3-aminophenyl)-N-[3-[(6-dibenzofuran-4-ylpyrimidin-4-yl)amino]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1cccc(N(C(=O)C(F)(F)F)c2cccc(Nc3cc(-c4cccc5c4oc4ccccc45)ncn3)c2)c1 |
| InChI | InChI=1S/C30H20F3N5O2/c31-30(32,33)29(39)38(20-8-3-6-18(34)14-20)21-9-4-7-19(15-21)37-27-16-25(35-17-36-27)24-12-5-11-23-22-10-1-2-13-26(22)40-28(23)24/h1-17H,34H2,(H,35,36,37) |
| InChIKey | OAYVUKRJALXOIV-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|