About bis(benzene-1,3-diol);4-chlorotriazine
bis(benzene-1,3-diol);4-chlorotriazine (PubChem CID 87216969) has the molecular formula C15H14ClN3O4
and a molecular weight of 335.75 g/mol. Its IUPAC name is bis(benzene-1,3-diol);4-chlorotriazine.
Molecular Properties
| Compound Name | bis(benzene-1,3-diol);4-chlorotriazine |
| PubChem CID | 87216969 |
| Molecular Formula | C15H14ClN3O4 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | bis(benzene-1,3-diol);4-chlorotriazine |
| SMILES | Clc1ccnnn1.Oc1cccc(O)c1.Oc1cccc(O)c1 |
| InChI | InChI=1S/2C6H6O2.C3H2ClN3/c2*7-5-2-1-3-6(8)4-5;4-3-1-2-5-7-6-3/h2*1-4,7-8H;1-2H |
| InChIKey | ZBAUGCWHGLUORD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis(benzene-1,3-diol);4-chlorotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzene-1,3-diol);4-chlorotriazine?
The IUPAC name of bis(benzene-1,3-diol);4-chlorotriazine (CID 87216969) is bis(benzene-1,3-diol);4-chlorotriazine.
What is the SMILES notation for bis(benzene-1,3-diol);4-chlorotriazine?
The canonical SMILES for bis(benzene-1,3-diol);4-chlorotriazine is Clc1ccnnn1.Oc1cccc(O)c1.Oc1cccc(O)c1.
What is the InChIKey of bis(benzene-1,3-diol);4-chlorotriazine?
The InChIKey is ZBAUGCWHGLUORD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6O2.C3H2ClN3/c2*7-5-2-1-3-6(8)4-5;4-3-1-2-5-7-6-3/h2*1-4,7-8H;1-2H.
What are the key properties of bis(benzene-1,3-diol);4-chlorotriazine?
bis(benzene-1,3-diol);4-chlorotriazine has a molecular weight of 335.75 g/mol, XLogP of 2.72, 0 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzene-1,3-diol);4-chlorotriazine is sourced from PubChem (CID 87216969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).