C20H34O7 — CID 87217106
trimethyl (Z,5R)-5-hydroxytetradec-2-ene-1,2,3-tricarboxylate (PubChem CID 87217106) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is trimethyl (Z,5R)-5-hydroxytetradec-2-ene-1,2,3-tricarboxylate.
| Compound Name | trimethyl (Z,5R)-5-hydroxytetradec-2-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 87217106 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | trimethyl (Z,5R)-5-hydroxytetradec-2-ene-1,2,3-tricarboxylate |
| SMILES | CCCCCCCCC[C@@H](O)C/C(C(=O)OC)=C(\CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C20H34O7/c1-5-6-7-8-9-10-11-12-15(21)13-16(19(23)26-3)17(20(24)27-4)14-18(22)25-2/h15,21H,5-14H2,1-4H3/b17-16-/t15-/m1/s1 |
| InChIKey | UIIKTMMQKJPQJN-KSPIOAOGSA-N |
| XLogP | 3.08 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|