C9H22O8 — CID 87217327
2,2-bis(hydroxymethyl)propane-1,3-diol;butane-1,2,2,3-tetrol (PubChem CID 87217327) has the molecular formula C9H22O8 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;butane-1,2,2,3-tetrol.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;butane-1,2,2,3-tetrol |
|---|---|
| PubChem CID | 87217327 |
| Molecular Formula | C9H22O8 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;butane-1,2,2,3-tetrol |
| SMILES | CC(O)C(O)(O)CO.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C4H10O4/c6-1-5(2-7,3-8)4-9;1-3(6)4(7,8)2-5/h6-9H,1-4H2;3,5-8H,2H2,1H3 |
| InChIKey | CMXCJQOCCWBJMI-UHFFFAOYSA-N |
| XLogP | -4.02 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|