C25H22F3N3O4S — CID 87217601
[4-[6-[(3,4-dimethylphenyl)carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate (PubChem CID 87217601) has the molecular formula C25H22F3N3O4S and a molecular weight of 517.53 g/mol. Its IUPAC name is [4-[6-[(3,4-dimethylphenyl)carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[6-[(3,4-dimethylphenyl)carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87217601 |
| Molecular Formula | C25H22F3N3O4S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | [4-[6-[(3,4-dimethylphenyl)carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(NC(=O)c2ccc3nc(-c4c(C)cc(OS(=O)(=O)C(F)(F)F)cc4C)[nH]c3c2)cc1C |
| InChI | InChI=1S/C25H22F3N3O4S/c1-13-5-7-18(9-14(13)2)29-24(32)17-6-8-20-21(12-17)31-23(30-20)22-15(3)10-19(11-16(22)4)35-36(33,34)25(26,27)28/h5-12H,1-4H3,(H,29,32)(H,30,31) |
| InChIKey | HGROZLOAHARTFF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|