C14H19N5O4S2 — CID 87217651
methanesulfonic acid;3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)benzenecarboximidamide (PubChem CID 87217651) has the molecular formula C14H19N5O4S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is methanesulfonic acid;3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)benzenecarboximidamide.
| Compound Name | methanesulfonic acid;3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 87217651 |
| Molecular Formula | C14H19N5O4S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | methanesulfonic acid;3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)benzenecarboximidamide |
| SMILES | CS(=O)(=O)O.[H]/N=C(\N)c1cccc(C2=NNC(=O)C3CSCCN23)c1 |
| InChI | InChI=1S/C13H15N5OS.CH4O3S/c14-11(15)8-2-1-3-9(6-8)12-16-17-13(19)10-7-20-5-4-18(10)12;1-5(2,3)4/h1-3,6,10H,4-5,7H2,(H3,14,15)(H,17,19);1H3,(H,2,3,4) |
| InChIKey | OKHFRLRZGSZISI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|