C13H16N4O4S — CID 87217678
methanesulfonic acid;8-pyridin-3-yl-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one (PubChem CID 87217678) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is methanesulfonic acid;8-pyridin-3-yl-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one.
| Compound Name | methanesulfonic acid;8-pyridin-3-yl-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 87217678 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | methanesulfonic acid;8-pyridin-3-yl-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one |
| SMILES | CS(=O)(=O)O.O=c1[nH]nc(-c2cccnc2)c2c1CCCN2 |
| InChI | InChI=1S/C12H12N4O.CH4O3S/c17-12-9-4-2-6-14-11(9)10(15-16-12)8-3-1-5-13-7-8;1-5(2,3)4/h1,3,5,7,14H,2,4,6H2,(H,16,17);1H3,(H,2,3,4) |
| InChIKey | VFIGJHLTOYDNAU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|