C25H19F3N4O4S2 — CID 87217703
[3,5-dimethyl-4-[6-[(2-methyl-1,3-benzothiazol-5-yl)carbamoyl]-1H-benzimidazol-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 87217703) has the molecular formula C25H19F3N4O4S2 and a molecular weight of 560.58 g/mol. Its IUPAC name is [3,5-dimethyl-4-[6-[(2-methyl-1,3-benzothiazol-5-yl)carbamoyl]-1H-benzimidazol-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dimethyl-4-[6-[(2-methyl-1,3-benzothiazol-5-yl)carbamoyl]-1H-benzimidazol-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87217703 |
| Molecular Formula | C25H19F3N4O4S2 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | [3,5-dimethyl-4-[6-[(2-methyl-1,3-benzothiazol-5-yl)carbamoyl]-1H-benzimidazol-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1nc2cc(NC(=O)c3ccc4nc(-c5c(C)cc(OS(=O)(=O)C(F)(F)F)cc5C)[nH]c4c3)ccc2s1 |
| InChI | InChI=1S/C25H19F3N4O4S2/c1-12-8-17(36-38(34,35)25(26,27)28)9-13(2)22(12)23-31-18-6-4-15(10-19(18)32-23)24(33)30-16-5-7-21-20(11-16)29-14(3)37-21/h4-11H,1-3H3,(H,30,33)(H,31,32) |
| InChIKey | CQPXYNMEHWQRDC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|