C25H19F3N4O4S2 — CID 87217704
[4-[6-[1,3-benzothiazol-5-yl(methyl)carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate (PubChem CID 87217704) has the molecular formula C25H19F3N4O4S2 and a molecular weight of 560.58 g/mol. Its IUPAC name is [4-[6-[1,3-benzothiazol-5-yl(methyl)carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[6-[1,3-benzothiazol-5-yl(methyl)carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87217704 |
| Molecular Formula | C25H19F3N4O4S2 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | [4-[6-[1,3-benzothiazol-5-yl(methyl)carbamoyl]-1H-benzimidazol-2-yl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(C)c1-c1nc2ccc(C(=O)N(C)c3ccc4scnc4c3)cc2[nH]1 |
| InChI | InChI=1S/C25H19F3N4O4S2/c1-13-8-17(36-38(34,35)25(26,27)28)9-14(2)22(13)23-30-18-6-4-15(10-19(18)31-23)24(33)32(3)16-5-7-21-20(11-16)29-12-37-21/h4-12H,1-3H3,(H,30,31) |
| InChIKey | IQYMJFXGSWXTDM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|