C18H25N3O4S — CID 87217845
4-[4-[(dimethylamino)methyl]phenyl]-5,6,7,8-tetrahydro-2H-phthalazin-1-one;methanesulfonic acid (PubChem CID 87217845) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-[4-[(dimethylamino)methyl]phenyl]-5,6,7,8-tetrahydro-2H-phthalazin-1-one;methanesulfonic acid.
| Compound Name | 4-[4-[(dimethylamino)methyl]phenyl]-5,6,7,8-tetrahydro-2H-phthalazin-1-one;methanesulfonic acid |
|---|---|
| PubChem CID | 87217845 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[4-[(dimethylamino)methyl]phenyl]-5,6,7,8-tetrahydro-2H-phthalazin-1-one;methanesulfonic acid |
| SMILES | CN(C)Cc1ccc(-c2n[nH]c(=O)c3c2CCCC3)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C17H21N3O.CH4O3S/c1-20(2)11-12-7-9-13(10-8-12)16-14-5-3-4-6-15(14)17(21)19-18-16;1-5(2,3)4/h7-10H,3-6,11H2,1-2H3,(H,19,21);1H3,(H,2,3,4) |
| InChIKey | MDDORAGNKKHCBF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|