C7H10N2O2S — CID 87218198
2-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 87218198) has the molecular formula C7H10N2O2S and a molecular weight of 193.28 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 87218198 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])Sc1nc(O)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O2S/c1-2-3-12-7-8-5(10)4-6(11)9-7/h4H,2-3H2,1H3,(H2,8,9,10,11)/i1D3,2D2,3D2 |
| InChIKey | JNDANYQUROGPBP-NCKGIQLSSA-N |
| XLogP | 0.98 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |