About 3,3-diphenyloxaziridine
3,3-diphenyloxaziridine (PubChem CID 87219330) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 3,3-diphenyloxaziridine.
Molecular Properties
| Compound Name | 3,3-diphenyloxaziridine |
| PubChem CID | 87219330 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 3,3-diphenyloxaziridine |
| SMILES | c1ccc(C2(c3ccccc3)NO2)cc1 |
| InChI | InChI=1S/C13H11NO/c1-3-7-11(8-4-1)13(14-15-13)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | XDVKDVJVGXOSRE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diphenyloxaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diphenyloxaziridine?
The IUPAC name of 3,3-diphenyloxaziridine (CID 87219330) is 3,3-diphenyloxaziridine.
What is the SMILES notation for 3,3-diphenyloxaziridine?
The canonical SMILES for 3,3-diphenyloxaziridine is c1ccc(C2(c3ccccc3)NO2)cc1.
What is the InChIKey of 3,3-diphenyloxaziridine?
The InChIKey is XDVKDVJVGXOSRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-3-7-11(8-4-1)13(14-15-13)12-9-5-2-6-10-12/h1-10,14H.
What are the key properties of 3,3-diphenyloxaziridine?
3,3-diphenyloxaziridine has a molecular weight of 197.24 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diphenyloxaziridine is sourced from PubChem (CID 87219330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).