C12H19NO4 — CID 87219506
8-(hydroxycarbamoyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid (PubChem CID 87219506) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 8-(hydroxycarbamoyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid.
| Compound Name | 8-(hydroxycarbamoyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 87219506 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 8-(hydroxycarbamoyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC2CCCC(C(=O)NO)C21 |
| InChI | InChI=1S/C12H19NO4/c14-11(13-17)8-5-1-3-7-4-2-6-9(10(7)8)12(15)16/h7-10,17H,1-6H2,(H,13,14)(H,15,16) |
| InChIKey | YJSJYHMMNCVGCS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|