C20H14Cl2F6N2O3 — CID 87219548
[2-(5,6-dichloro-1H-benzimidazol-2-yl)-1,1,1-trifluoropropan-2-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 87219548) has the molecular formula C20H14Cl2F6N2O3 and a molecular weight of 515.24 g/mol. Its IUPAC name is [2-(5,6-dichloro-1H-benzimidazol-2-yl)-1,1,1-trifluoropropan-2-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [2-(5,6-dichloro-1H-benzimidazol-2-yl)-1,1,1-trifluoropropan-2-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 87219548 |
| Molecular Formula | C20H14Cl2F6N2O3 |
| Molecular Weight | 515.24 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | [2-(5,6-dichloro-1H-benzimidazol-2-yl)-1,1,1-trifluoropropan-2-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(C(=O)OC(C)(c1nc2cc(Cl)c(Cl)cc2[nH]1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H14Cl2F6N2O3/c1-17(19(23,24)25,15-29-13-8-11(21)12(22)9-14(13)30-15)33-16(31)18(32-2,20(26,27)28)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,29,30) |
| InChIKey | LQOMRNOQUFAIAD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.24 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |