C10H7F8N3 — CID 87219565
2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (PubChem CID 87219565) has the molecular formula C10H7F8N3 and a molecular weight of 321.17 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 87219565 |
| Molecular Formula | C10H7F8N3 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| SMILES | FC(F)(F)c1nc(C(F)(F)C(F)(F)F)nc2c1CCNC2 |
| InChI | InChI=1S/C10H7F8N3/c11-8(12,10(16,17)18)7-20-5-3-19-2-1-4(5)6(21-7)9(13,14)15/h19H,1-3H2 |
| InChIKey | CLKAPBWHUIQNNN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|