C14H15Cl2F3O3 — CID 87219595
(2R,4R)-4-(3,4-dichloro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hexanal (PubChem CID 87219595) has the molecular formula C14H15Cl2F3O3 and a molecular weight of 359.17 g/mol. Its IUPAC name is (2R,4R)-4-(3,4-dichloro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hexanal.
| Compound Name | (2R,4R)-4-(3,4-dichloro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hexanal |
|---|---|
| PubChem CID | 87219595 |
| Molecular Formula | C14H15Cl2F3O3 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (2R,4R)-4-(3,4-dichloro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hexanal |
| SMILES | CC[C@H](C[C@@](O)(C=O)C(F)(F)F)c1ccc(Cl)c(Cl)c1OC |
| InChI | InChI=1S/C14H15Cl2F3O3/c1-3-8(6-13(21,7-20)14(17,18)19)9-4-5-10(15)11(16)12(9)22-2/h4-5,7-8,21H,3,6H2,1-2H3/t8-,13-/m1/s1 |
| InChIKey | JYXLWAYGQKLDOS-AMIZOPFISA-N |
| XLogP | 4.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|