About 3,4,5-trimethyl-7-oxooctanal
3,4,5-trimethyl-7-oxooctanal (PubChem CID 87219709) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 3,4,5-trimethyl-7-oxooctanal.
Molecular Properties
| Compound Name | 3,4,5-trimethyl-7-oxooctanal |
| PubChem CID | 87219709 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 3,4,5-trimethyl-7-oxooctanal |
| SMILES | CC(=O)CC(C)C(C)C(C)CC=O |
| InChI | InChI=1S/C11H20O2/c1-8(5-6-12)11(4)9(2)7-10(3)13/h6,8-9,11H,5,7H2,1-4H3 |
| InChIKey | IJGFCHJDWWOTQL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trimethyl-7-oxooctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trimethyl-7-oxooctanal?
The IUPAC name of 3,4,5-trimethyl-7-oxooctanal (CID 87219709) is 3,4,5-trimethyl-7-oxooctanal.
What is the SMILES notation for 3,4,5-trimethyl-7-oxooctanal?
The canonical SMILES for 3,4,5-trimethyl-7-oxooctanal is CC(=O)CC(C)C(C)C(C)CC=O.
What is the InChIKey of 3,4,5-trimethyl-7-oxooctanal?
The InChIKey is IJGFCHJDWWOTQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-8(5-6-12)11(4)9(2)7-10(3)13/h6,8-9,11H,5,7H2,1-4H3.
What are the key properties of 3,4,5-trimethyl-7-oxooctanal?
3,4,5-trimethyl-7-oxooctanal has a molecular weight of 184.28 g/mol, XLogP of 2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trimethyl-7-oxooctanal is sourced from PubChem (CID 87219709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).