C22H22N2O5 — CID 87219828
N-hydroxy-2-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]-1,3,4,5-tetrahydro-2-benzazepine-7-carboxamide (PubChem CID 87219828) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-hydroxy-2-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]-1,3,4,5-tetrahydro-2-benzazepine-7-carboxamide.
| Compound Name | N-hydroxy-2-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]-1,3,4,5-tetrahydro-2-benzazepine-7-carboxamide |
|---|---|
| PubChem CID | 87219828 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-hydroxy-2-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]-1,3,4,5-tetrahydro-2-benzazepine-7-carboxamide |
| SMILES | COc1ccc2c(CC(=O)N3CCCc4cc(C(=O)NO)ccc4C3)coc2c1 |
| InChI | InChI=1S/C22H22N2O5/c1-28-18-6-7-19-17(13-29-20(19)11-18)10-21(25)24-8-2-3-14-9-15(22(26)23-27)4-5-16(14)12-24/h4-7,9,11,13,27H,2-3,8,10,12H2,1H3,(H,23,26) |
| InChIKey | MXWZGBUWWHLEDJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|