About azane;4,4-dipropylheptyl undec-10-enoate
azane;4,4-dipropylheptyl undec-10-enoate (PubChem CID 87220290) has the molecular formula C24H49NO2
and a molecular weight of 383.66 g/mol. Its IUPAC name is azane;4,4-dipropylheptyl undec-10-enoate.
Molecular Properties
| Compound Name | azane;4,4-dipropylheptyl undec-10-enoate |
| PubChem CID | 87220290 |
| Molecular Formula | C24H49NO2 |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 383.38 |
| IUPAC Name | azane;4,4-dipropylheptyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCCCC(CCC)(CCC)CCC.N |
| InChI | InChI=1S/C24H46O2.H3N/c1-5-9-10-11-12-13-14-15-17-23(25)26-22-16-21-24(18-6-2,19-7-3)20-8-4;/h5H,1,6-22H2,2-4H3;1H3 |
| InChIKey | IBOHNDIBWIFSDU-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;4,4-dipropylheptyl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4,4-dipropylheptyl undec-10-enoate?
The IUPAC name of azane;4,4-dipropylheptyl undec-10-enoate (CID 87220290) is azane;4,4-dipropylheptyl undec-10-enoate.
What is the SMILES notation for azane;4,4-dipropylheptyl undec-10-enoate?
The canonical SMILES for azane;4,4-dipropylheptyl undec-10-enoate is C=CCCCCCCCCC(=O)OCCCC(CCC)(CCC)CCC.N.
What is the InChIKey of azane;4,4-dipropylheptyl undec-10-enoate?
The InChIKey is IBOHNDIBWIFSDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O2.H3N/c1-5-9-10-11-12-13-14-15-17-23(25)26-22-16-21-24(18-6-2,19-7-3)20-8-4;/h5H,1,6-22H2,2-4H3;1H3.
What are the key properties of azane;4,4-dipropylheptyl undec-10-enoate?
azane;4,4-dipropylheptyl undec-10-enoate has a molecular weight of 383.66 g/mol, XLogP of 8.17, 19 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4,4-dipropylheptyl undec-10-enoate is sourced from PubChem (CID 87220290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).