About azane;3,3-dibutylheptyl undec-10-enoate
azane;3,3-dibutylheptyl undec-10-enoate (PubChem CID 87220498) has the molecular formula C26H53NO2
and a molecular weight of 411.72 g/mol. Its IUPAC name is azane;3,3-dibutylheptyl undec-10-enoate.
Molecular Properties
| Compound Name | azane;3,3-dibutylheptyl undec-10-enoate |
| PubChem CID | 87220498 |
| Molecular Formula | C26H53NO2 |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.41 |
| IUPAC Name | azane;3,3-dibutylheptyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCCC(CCCC)(CCCC)CCCC.N |
| InChI | InChI=1S/C26H50O2.H3N/c1-5-9-13-14-15-16-17-18-19-25(27)28-24-23-26(20-10-6-2,21-11-7-3)22-12-8-4;/h5H,1,6-24H2,2-4H3;1H3 |
| InChIKey | MLRLFMOZNAANNG-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;3,3-dibutylheptyl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3,3-dibutylheptyl undec-10-enoate?
The IUPAC name of azane;3,3-dibutylheptyl undec-10-enoate (CID 87220498) is azane;3,3-dibutylheptyl undec-10-enoate.
What is the SMILES notation for azane;3,3-dibutylheptyl undec-10-enoate?
The canonical SMILES for azane;3,3-dibutylheptyl undec-10-enoate is C=CCCCCCCCCC(=O)OCCC(CCCC)(CCCC)CCCC.N.
What is the InChIKey of azane;3,3-dibutylheptyl undec-10-enoate?
The InChIKey is MLRLFMOZNAANNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H50O2.H3N/c1-5-9-13-14-15-16-17-18-19-25(27)28-24-23-26(20-10-6-2,21-11-7-3)22-12-8-4;/h5H,1,6-24H2,2-4H3;1H3.
What are the key properties of azane;3,3-dibutylheptyl undec-10-enoate?
azane;3,3-dibutylheptyl undec-10-enoate has a molecular weight of 411.72 g/mol, XLogP of 8.95, 21 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3,3-dibutylheptyl undec-10-enoate is sourced from PubChem (CID 87220498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).