About 1-N,1-N'-diethylprop-1-ene-1,1-diamine
1-N,1-N'-diethylprop-1-ene-1,1-diamine (PubChem CID 87221910) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-N,1-N'-diethylprop-1-ene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N,1-N'-diethylprop-1-ene-1,1-diamine |
| PubChem CID | 87221910 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-N,1-N'-diethylprop-1-ene-1,1-diamine |
| SMILES | CC=C(NCC)NCC |
| InChI | InChI=1S/C7H16N2/c1-4-7(8-5-2)9-6-3/h4,8-9H,5-6H2,1-3H3 |
| InChIKey | RAKPPGUBRSGSSP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,1-N'-diethylprop-1-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N'-diethylprop-1-ene-1,1-diamine?
The IUPAC name of 1-N,1-N'-diethylprop-1-ene-1,1-diamine (CID 87221910) is 1-N,1-N'-diethylprop-1-ene-1,1-diamine.
What is the SMILES notation for 1-N,1-N'-diethylprop-1-ene-1,1-diamine?
The canonical SMILES for 1-N,1-N'-diethylprop-1-ene-1,1-diamine is CC=C(NCC)NCC.
What is the InChIKey of 1-N,1-N'-diethylprop-1-ene-1,1-diamine?
The InChIKey is RAKPPGUBRSGSSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c1-4-7(8-5-2)9-6-3/h4,8-9H,5-6H2,1-3H3.
What are the key properties of 1-N,1-N'-diethylprop-1-ene-1,1-diamine?
1-N,1-N'-diethylprop-1-ene-1,1-diamine has a molecular weight of 128.22 g/mol, XLogP of 1.07, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N'-diethylprop-1-ene-1,1-diamine is sourced from PubChem (CID 87221910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).