C6H6F9O3P — CID 87221960
1,1,1,3-tetrafluoro-3-[fluoro(1,3,3,3-tetrafluoropropoxy)phosphoryl]oxypropane (PubChem CID 87221960) has the molecular formula C6H6F9O3P and a molecular weight of 328.07 g/mol. Its IUPAC name is 1,1,1,3-tetrafluoro-3-[fluoro(1,3,3,3-tetrafluoropropoxy)phosphoryl]oxypropane.
| Compound Name | 1,1,1,3-tetrafluoro-3-[fluoro(1,3,3,3-tetrafluoropropoxy)phosphoryl]oxypropane |
|---|---|
| PubChem CID | 87221960 |
| Molecular Formula | C6H6F9O3P |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 1,1,1,3-tetrafluoro-3-[fluoro(1,3,3,3-tetrafluoropropoxy)phosphoryl]oxypropane |
| SMILES | O=P(F)(OC(F)CC(F)(F)F)OC(F)CC(F)(F)F |
| InChI | InChI=1S/C6H6F9O3P/c7-3(1-5(9,10)11)17-19(15,16)18-4(8)2-6(12,13)14/h3-4H,1-2H2 |
| InChIKey | AROVJPNQZSONGJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|