About water triethoxysilane
water triethoxysilane (PubChem CID 87222130) has the molecular formula C6H17O4Si
and a molecular weight of 181.28 g/mol.
Molecular Properties
| Compound Name | water triethoxysilane |
| PubChem CID | 87222130 |
| Molecular Formula | C6H17O4Si |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)OCC.O |
| InChI | InChI=1S/C6H15O3Si.H2O/c1-4-7-10(8-5-2)9-6-3;/h4-6H2,1-3H3;1H2 |
| InChIKey | LVYXGGYDIJLZLS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze water triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of water triethoxysilane?
The IUPAC name of water triethoxysilane (CID 87222130) is not available.
What is the SMILES notation for water triethoxysilane?
The canonical SMILES for water triethoxysilane is CCO[Si](OCC)OCC.O.
What is the InChIKey of water triethoxysilane?
The InChIKey is LVYXGGYDIJLZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15O3Si.H2O/c1-4-7-10(8-5-2)9-6-3;/h4-6H2,1-3H3;1H2.
What are the key properties of water triethoxysilane?
water triethoxysilane has a molecular weight of 181.28 g/mol, XLogP of 0.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for water triethoxysilane is sourced from PubChem (CID 87222130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).