About 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid
2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid (PubChem CID 87222259) has the molecular formula C9H10Cl2O4
and a molecular weight of 253.08 g/mol. Its IUPAC name is 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid |
| PubChem CID | 87222259 |
| Molecular Formula | C9H10Cl2O4 |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid |
| SMILES | CC1(C(=O)Cl)CC(C(=O)Cl)C1(C)C(=O)O |
| InChI | InChI=1S/C9H10Cl2O4/c1-8(6(11)13)3-4(5(10)12)9(8,2)7(14)15/h4H,3H2,1-2H3,(H,14,15) |
| InChIKey | IHHQMRRFULSMJM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid?
The IUPAC name of 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid (CID 87222259) is 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid.
What is the SMILES notation for 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid?
The canonical SMILES for 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid is CC1(C(=O)Cl)CC(C(=O)Cl)C1(C)C(=O)O.
What is the InChIKey of 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid?
The InChIKey is IHHQMRRFULSMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2O4/c1-8(6(11)13)3-4(5(10)12)9(8,2)7(14)15/h4H,3H2,1-2H3,(H,14,15).
What are the key properties of 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid?
2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid has a molecular weight of 253.08 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dicarbonochloridoyl-1,2-dimethylcyclobutane-1-carboxylic acid is sourced from PubChem (CID 87222259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).