About 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde
3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 87222611) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 87222611 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | COC1(C(C)(C)C)C=C(C=O)C=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H26O2/c1-14(2,3)13-8-12(11-17)9-16(10-13,18-7)15(4,5)6/h8-9,11H,10H2,1-7H3 |
| InChIKey | SMKZODHQDSUEKO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde (CID 87222611) is 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde is COC1(C(C)(C)C)C=C(C=O)C=C(C(C)(C)C)C1.
What is the InChIKey of 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is SMKZODHQDSUEKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2/c1-14(2,3)13-8-12(11-17)9-16(10-13,18-7)15(4,5)6/h8-9,11H,10H2,1-7H3.
What are the key properties of 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde?
3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 250.38 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-3-methoxycyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 87222611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).