C17H17NO7 — CID 87222869
[3-[(2-hydroxybenzoyl)amino]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] propan-2-yl carbonate (PubChem CID 87222869) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is [3-[(2-hydroxybenzoyl)amino]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] propan-2-yl carbonate.
| Compound Name | [3-[(2-hydroxybenzoyl)amino]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 87222869 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [3-[(2-hydroxybenzoyl)amino]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OC1C(NC(=O)c2ccccc2O)=CC(=O)C2OC21 |
| InChI | InChI=1S/C17H17NO7/c1-8(2)23-17(22)25-13-10(7-12(20)14-15(13)24-14)18-16(21)9-5-3-4-6-11(9)19/h3-8,13-15,19H,1-2H3,(H,18,21) |
| InChIKey | YLPZVVSUBVXOPG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|