C26H34F3N5O5 — CID 87224584
(3S,6S,10aS)-6-[2-(methylamino)propanoylamino]-5-oxo-N-[[3-[(4,4,4-trifluoro-3-oxobutanoyl)amino]phenyl]methyl]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide (PubChem CID 87224584) has the molecular formula C26H34F3N5O5 and a molecular weight of 553.58 g/mol. Its IUPAC name is (3S,6S,10aS)-6-[2-(methylamino)propanoylamino]-5-oxo-N-[[3-[(4,4,4-trifluoro-3-oxobutanoyl)amino]phenyl]methyl]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide.
| Compound Name | (3S,6S,10aS)-6-[2-(methylamino)propanoylamino]-5-oxo-N-[[3-[(4,4,4-trifluoro-3-oxobutanoyl)amino]phenyl]methyl]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
|---|---|
| PubChem CID | 87224584 |
| Molecular Formula | C26H34F3N5O5 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | (3S,6S,10aS)-6-[2-(methylamino)propanoylamino]-5-oxo-N-[[3-[(4,4,4-trifluoro-3-oxobutanoyl)amino]phenyl]methyl]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
| SMILES | CNC(C)C(=O)N[C@H]1CCCC[C@H]2CC[C@@H](C(=O)NCc3cccc(NC(=O)CC(=O)C(F)(F)F)c3)N2C1=O |
| InChI | InChI=1S/C26H34F3N5O5/c1-15(30-2)23(37)33-19-9-4-3-8-18-10-11-20(34(18)25(19)39)24(38)31-14-16-6-5-7-17(12-16)32-22(36)13-21(35)26(27,28)29/h5-7,12,15,18-20,30H,3-4,8-11,13-14H2,1-2H3,(H,31,38)(H,32,36)(H,33,37)/t15?,18-,19-,20-/m0/s1 |
| InChIKey | WMFPRSFGWXMVFY-FBOXXWIASA-N |
| XLogP | 1.79 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|