About 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid
5-ethoxy-2-methylidene-4,5-dioxopentanoic acid (PubChem CID 87224646) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid.
Molecular Properties
| Compound Name | 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid |
| PubChem CID | 87224646 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid |
| SMILES | C=C(CC(=O)C(=O)OCC)C(=O)O |
| InChI | InChI=1S/C8H10O5/c1-3-13-8(12)6(9)4-5(2)7(10)11/h2-4H2,1H3,(H,10,11) |
| InChIKey | VZIMIJUMXNTSKD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid?
The IUPAC name of 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid (CID 87224646) is 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid.
What is the SMILES notation for 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid?
The canonical SMILES for 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid is C=C(CC(=O)C(=O)OCC)C(=O)O.
What is the InChIKey of 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid?
The InChIKey is VZIMIJUMXNTSKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c1-3-13-8(12)6(9)4-5(2)7(10)11/h2-4H2,1H3,(H,10,11).
What are the key properties of 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid?
5-ethoxy-2-methylidene-4,5-dioxopentanoic acid has a molecular weight of 186.16 g/mol, XLogP of 0.15, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2-methylidene-4,5-dioxopentanoic acid is sourced from PubChem (CID 87224646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).