About N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene
N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene (PubChem CID 87225126) has the molecular formula C10H22FNO
and a molecular weight of 191.29 g/mol. Its IUPAC name is N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene |
| PubChem CID | 87225126 |
| Molecular Formula | C10H22FNO |
| Molecular Weight | 191.29 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene |
| SMILES | C=C(C)COC(F)CC.CN(C)C |
| InChI | InChI=1S/C7H13FO.C3H9N/c1-4-7(8)9-5-6(2)3;1-4(2)3/h7H,2,4-5H2,1,3H3;1-3H3 |
| InChIKey | KRRFTKDWYOHWPJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene?
The IUPAC name of N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene (CID 87225126) is N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene.
What is the SMILES notation for N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene?
The canonical SMILES for N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene is C=C(C)COC(F)CC.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene?
The InChIKey is KRRFTKDWYOHWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO.C3H9N/c1-4-7(8)9-5-6(2)3;1-4(2)3/h7H,2,4-5H2,1,3H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene?
N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene has a molecular weight of 191.29 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;3-(1-fluoropropoxy)-2-methylprop-1-ene is sourced from PubChem (CID 87225126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).