About (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate
(1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate (PubChem CID 87225444) has the molecular formula C9H12Br2O11
and a molecular weight of 455.99 g/mol. Its IUPAC name is (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate.
Molecular Properties
| Compound Name | (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate |
| PubChem CID | 87225444 |
| Molecular Formula | C9H12Br2O11 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 453.87 |
| IUPAC Name | (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate |
| SMILES | CC(C)(CO)C(Br)OBr.O=C(O)OC(=O)OC(=O)OC(=O)O |
| InChI | InChI=1S/C5H10Br2O2.C4H2O9/c1-5(2,3-8)4(6)9-7;5-1(6)11-3(9)13-4(10)12-2(7)8/h4,8H,3H2,1-2H3;(H,5,6)(H,7,8) |
| InChIKey | AYQDOWJDRMBPSQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate?
The IUPAC name of (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate (CID 87225444) is (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate.
What is the SMILES notation for (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate?
The canonical SMILES for (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate is CC(C)(CO)C(Br)OBr.O=C(O)OC(=O)OC(=O)OC(=O)O.
What is the InChIKey of (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate?
The InChIKey is AYQDOWJDRMBPSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10Br2O2.C4H2O9/c1-5(2,3-8)4(6)9-7;5-1(6)11-3(9)13-4(10)12-2(7)8/h4,8H,3H2,1-2H3;(H,5,6)(H,7,8).
What are the key properties of (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate?
(1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate has a molecular weight of 455.99 g/mol, XLogP of 2.68, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;carboxy carboxyoxycarbonyl carbonate is sourced from PubChem (CID 87225444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).