C32H28N2O — CID 87226046
(1R,9R,13E)-1-[[(E)-3-anthracen-9-ylprop-2-enylidene]amino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one (PubChem CID 87226046) has the molecular formula C32H28N2O and a molecular weight of 456.59 g/mol. Its IUPAC name is (1R,9R,13E)-1-[[(E)-3-anthracen-9-ylprop-2-enylidene]amino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one.
| Compound Name | (1R,9R,13E)-1-[[(E)-3-anthracen-9-ylprop-2-enylidene]amino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
|---|---|
| PubChem CID | 87226046 |
| Molecular Formula | C32H28N2O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (1R,9R,13E)-1-[[(E)-3-anthracen-9-ylprop-2-enylidene]amino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
| SMILES | C/C=C1\[C@H]2C=C(C)C[C@]1(/N=C/C=C/c1c3ccccc3cc3ccccc13)c1ccc(=O)[nH]c1C2 |
| InChI | InChI=1S/C32H28N2O/c1-3-28-24-17-21(2)20-32(28,29-14-15-31(35)34-30(29)19-24)33-16-8-13-27-25-11-6-4-9-22(25)18-23-10-5-7-12-26(23)27/h3-18,24H,19-20H2,1-2H3,(H,34,35)/b13-8+,28-3+,33-16+/t24-,32+/m0/s1 |
| InChIKey | RUWOFBBSEMTPBN-MDWGXHDKSA-N |
| XLogP | 7.13 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|