C24H23BrN2O — CID 87226096
(1R,9R,13E)-1-[[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one (PubChem CID 87226096) has the molecular formula C24H23BrN2O and a molecular weight of 435.37 g/mol. Its IUPAC name is (1R,9R,13E)-1-[[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one.
| Compound Name | (1R,9R,13E)-1-[[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
|---|---|
| PubChem CID | 87226096 |
| Molecular Formula | C24H23BrN2O |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (1R,9R,13E)-1-[[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
| SMILES | C/C=C1\[C@H]2C=C(C)C[C@]1(/N=C/C(Br)=C/c1ccccc1)c1ccc(=O)[nH]c1C2 |
| InChI | InChI=1S/C24H23BrN2O/c1-3-20-18-11-16(2)14-24(20,21-9-10-23(28)27-22(21)13-18)26-15-19(25)12-17-7-5-4-6-8-17/h3-12,15,18H,13-14H2,1-2H3,(H,27,28)/b19-12-,20-3+,26-15+/t18-,24+/m0/s1 |
| InChIKey | ZPDKSTIGRFMYBP-YUHLBFRGSA-N |
| XLogP | 5.55 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|