About 1H-selenopheno[2,3-d]pyrazole
1H-selenopheno[2,3-d]pyrazole (PubChem CID 87226097) has the molecular formula C5H4N2Se
and a molecular weight of 171.06 g/mol. Its IUPAC name is 1H-selenopheno[2,3-d]pyrazole.
Molecular Properties
| Compound Name | 1H-selenopheno[2,3-d]pyrazole |
| PubChem CID | 87226097 |
| Molecular Formula | C5H4N2Se |
| Molecular Weight | 171.06 g/mol |
| Exact Mass | 171.95 |
| IUPAC Name | 1H-selenopheno[2,3-d]pyrazole |
| SMILES | c1cc2[nH]ncc2[se]1 |
| InChI | InChI=1S/C5H4N2Se/c1-2-8-5-3-6-7-4(1)5/h1-3H,(H,6,7) |
| InChIKey | IBJXGVTWKUEIJR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.06 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-selenopheno[2,3-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-selenopheno[2,3-d]pyrazole?
The IUPAC name of 1H-selenopheno[2,3-d]pyrazole (CID 87226097) is 1H-selenopheno[2,3-d]pyrazole.
What is the SMILES notation for 1H-selenopheno[2,3-d]pyrazole?
The canonical SMILES for 1H-selenopheno[2,3-d]pyrazole is c1cc2[nH]ncc2[se]1.
What is the InChIKey of 1H-selenopheno[2,3-d]pyrazole?
The InChIKey is IBJXGVTWKUEIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2Se/c1-2-8-5-3-6-7-4(1)5/h1-3H,(H,6,7).
What are the key properties of 1H-selenopheno[2,3-d]pyrazole?
1H-selenopheno[2,3-d]pyrazole has a molecular weight of 171.06 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-selenopheno[2,3-d]pyrazole is sourced from PubChem (CID 87226097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).