1,1,2-trifluoropropyl hydrogen carbonate

C4H5F3O3 — CID 87226804

IUPAC1,1,2-trifluoropropyl hydrogen carbonate
SMILESCC(F)C(F)(F)OC(=O)O
InChIInChI=1S/C4H5F3O3/c1-2(5)4(6,7)10-3(8)9/h2H,1H3,(H,8,9)
InChIKeyGUJBBZGJZRPSOS-UHFFFAOYSA-N
MW158.07 g/mol
LogP1.63
Rot. Bonds2

About 1,1,2-trifluoropropyl hydrogen carbonate

1,1,2-trifluoropropyl hydrogen carbonate (PubChem CID 87226804) has the molecular formula C4H5F3O3 and a molecular weight of 158.07 g/mol. Its IUPAC name is 1,1,2-trifluoropropyl hydrogen carbonate.

Molecular Properties

Compound Name1,1,2-trifluoropropyl hydrogen carbonate
PubChem CID87226804
Molecular FormulaC4H5F3O3
Molecular Weight158.07 g/mol
Exact Mass158.02
IUPAC Name1,1,2-trifluoropropyl hydrogen carbonate
SMILESCC(F)C(F)(F)OC(=O)O
InChIInChI=1S/C4H5F3O3/c1-2(5)4(6,7)10-3(8)9/h2H,1H3,(H,8,9)
InChIKeyGUJBBZGJZRPSOS-UHFFFAOYSA-N
XLogP1.63
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.07
LogP ≤ 51.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,1,2-trifluoropropyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1,2-trifluoropropyl hydrogen carbonate?
The IUPAC name of 1,1,2-trifluoropropyl hydrogen carbonate (CID 87226804) is 1,1,2-trifluoropropyl hydrogen carbonate.
What is the SMILES notation for 1,1,2-trifluoropropyl hydrogen carbonate?
The canonical SMILES for 1,1,2-trifluoropropyl hydrogen carbonate is CC(F)C(F)(F)OC(=O)O.
What is the InChIKey of 1,1,2-trifluoropropyl hydrogen carbonate?
The InChIKey is GUJBBZGJZRPSOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3O3/c1-2(5)4(6,7)10-3(8)9/h2H,1H3,(H,8,9).
What are the key properties of 1,1,2-trifluoropropyl hydrogen carbonate?
1,1,2-trifluoropropyl hydrogen carbonate has a molecular weight of 158.07 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trifluoropropyl hydrogen carbonate is sourced from PubChem (CID 87226804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).