About magnesium;1,2-dimethylbenzene-6-ide;iodide
magnesium;1,2-dimethylbenzene-6-ide;iodide (PubChem CID 87227373) has the molecular formula C8H9IMg
and a molecular weight of 256.37 g/mol. Its IUPAC name is magnesium;1,2-dimethylbenzene-6-ide;iodide.
Molecular Properties
| Compound Name | magnesium;1,2-dimethylbenzene-6-ide;iodide |
| PubChem CID | 87227373 |
| Molecular Formula | C8H9IMg |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | magnesium;1,2-dimethylbenzene-6-ide;iodide |
| SMILES | Cc1[c-]cccc1C.[I-].[Mg+2] |
| InChI | InChI=1S/C8H9.HI.Mg/c1-7-5-3-4-6-8(7)2;;/h3-5H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | LDTAAEYOFHVRDL-UHFFFAOYSA-M |
| XLogP | -1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1,2-dimethylbenzene-6-ide;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,2-dimethylbenzene-6-ide;iodide?
The IUPAC name of magnesium;1,2-dimethylbenzene-6-ide;iodide (CID 87227373) is magnesium;1,2-dimethylbenzene-6-ide;iodide.
What is the SMILES notation for magnesium;1,2-dimethylbenzene-6-ide;iodide?
The canonical SMILES for magnesium;1,2-dimethylbenzene-6-ide;iodide is Cc1[c-]cccc1C.[I-].[Mg+2].
What is the InChIKey of magnesium;1,2-dimethylbenzene-6-ide;iodide?
The InChIKey is LDTAAEYOFHVRDL-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9.HI.Mg/c1-7-5-3-4-6-8(7)2;;/h3-5H,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1,2-dimethylbenzene-6-ide;iodide?
magnesium;1,2-dimethylbenzene-6-ide;iodide has a molecular weight of 256.37 g/mol, XLogP of -1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,2-dimethylbenzene-6-ide;iodide is sourced from PubChem (CID 87227373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).