About N-decyl-1,1,1-trifluoromethanesulfonamide
N-decyl-1,1,1-trifluoromethanesulfonamide (PubChem CID 87227692) has the molecular formula C11H22F3NO2S
and a molecular weight of 289.36 g/mol. Its IUPAC name is N-decyl-1,1,1-trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-decyl-1,1,1-trifluoromethanesulfonamide |
| PubChem CID | 87227692 |
| Molecular Formula | C11H22F3NO2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-decyl-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCCCCCCCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H22F3NO2S/c1-2-3-4-5-6-7-8-9-10-15-18(16,17)11(12,13)14/h15H,2-10H2,1H3 |
| InChIKey | DRFCOTAPCXTTDY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-decyl-1,1,1-trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decyl-1,1,1-trifluoromethanesulfonamide?
The IUPAC name of N-decyl-1,1,1-trifluoromethanesulfonamide (CID 87227692) is N-decyl-1,1,1-trifluoromethanesulfonamide.
What is the SMILES notation for N-decyl-1,1,1-trifluoromethanesulfonamide?
The canonical SMILES for N-decyl-1,1,1-trifluoromethanesulfonamide is CCCCCCCCCCNS(=O)(=O)C(F)(F)F.
What is the InChIKey of N-decyl-1,1,1-trifluoromethanesulfonamide?
The InChIKey is DRFCOTAPCXTTDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3NO2S/c1-2-3-4-5-6-7-8-9-10-15-18(16,17)11(12,13)14/h15H,2-10H2,1H3.
What are the key properties of N-decyl-1,1,1-trifluoromethanesulfonamide?
N-decyl-1,1,1-trifluoromethanesulfonamide has a molecular weight of 289.36 g/mol, XLogP of 3.57, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-decyl-1,1,1-trifluoromethanesulfonamide is sourced from PubChem (CID 87227692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).